C34H31N3O5 — CID 6641418
(2R,3S,8R,10R)-2-(1-hydroxynaphthalen-2-yl)-3,5,6,8-tetramethyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 6641418) has the molecular formula C34H31N3O5 and a molecular weight of 561.64 g/mol. Its IUPAC name is (2R,3S,8R,10R)-2-(1-hydroxynaphthalen-2-yl)-3,5,6,8-tetramethyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | (2R,3S,8R,10R)-2-(1-hydroxynaphthalen-2-yl)-3,5,6,8-tetramethyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6641418 |
| Molecular Formula | C34H31N3O5 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | (2R,3S,8R,10R)-2-(1-hydroxynaphthalen-2-yl)-3,5,6,8-tetramethyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | CC1=C(C)C(=O)[C@@]2(C)[C@@H](c3ccc4ccccc4c3O)C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4[C@@H]3C[C@@]2(C)C1=O |
| InChI | InChI=1S/C34H31N3O5/c1-19-20(2)30(40)34(4)27(25-15-14-21-10-8-9-13-23(21)28(25)38)24-16-17-35-31(41)36(22-11-6-5-7-12-22)32(42)37(35)26(24)18-33(34,3)29(19)39/h5-16,26-27,38H,17-18H2,1-4H3/t26-,27-,33+,34-/m1/s1 |
| InChIKey | DDMNAIAUVWEZAR-VHLJGYRNSA-N |
| XLogP | 4.83 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|