C30H28BrN3O5 — CID 6641325
(2R,3S,8R,10R)-2-(5-bromo-2-hydroxyphenyl)-3,5,6,8-tetramethyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 6641325) has the molecular formula C30H28BrN3O5 and a molecular weight of 590.47 g/mol. Its IUPAC name is (2R,3S,8R,10R)-2-(5-bromo-2-hydroxyphenyl)-3,5,6,8-tetramethyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | (2R,3S,8R,10R)-2-(5-bromo-2-hydroxyphenyl)-3,5,6,8-tetramethyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6641325 |
| Molecular Formula | C30H28BrN3O5 |
| Molecular Weight | 590.47 g/mol |
| Exact Mass | 589.12 |
| IUPAC Name | (2R,3S,8R,10R)-2-(5-bromo-2-hydroxyphenyl)-3,5,6,8-tetramethyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | CC1=C(C)C(=O)[C@@]2(C)[C@@H](c3cc(Br)ccc3O)C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4[C@@H]3C[C@@]2(C)C1=O |
| InChI | InChI=1S/C30H28BrN3O5/c1-16-17(2)26(37)30(4)24(21-14-18(31)10-11-23(21)35)20-12-13-32-27(38)33(19-8-6-5-7-9-19)28(39)34(32)22(20)15-29(30,3)25(16)36/h5-12,14,22,24,35H,13,15H2,1-4H3/t22-,24-,29+,30-/m1/s1 |
| InChIKey | PYLFMPCMLPBZEE-MMWYEGISSA-N |
| XLogP | 4.44 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|