C26H17BrIN3O5 — CID 5052135
2-(5-bromo-2-hydroxyphenyl)-5-iodo-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone (PubChem CID 5052135) has the molecular formula C26H17BrIN3O5 and a molecular weight of 658.25 g/mol. Its IUPAC name is 2-(5-bromo-2-hydroxyphenyl)-5-iodo-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone.
| Compound Name | 2-(5-bromo-2-hydroxyphenyl)-5-iodo-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 5052135 |
| Molecular Formula | C26H17BrIN3O5 |
| Molecular Weight | 658.25 g/mol |
| Exact Mass | 656.94 |
| IUPAC Name | 2-(5-bromo-2-hydroxyphenyl)-5-iodo-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone |
| SMILES | O=C1C=C(I)C(=O)C2=C1CC1C(=CCn3c(=O)n(-c4ccccc4)c(=O)n31)C2c1cc(Br)ccc1O |
| InChI | InChI=1S/C26H17BrIN3O5/c27-13-6-7-20(32)16(10-13)22-15-8-9-29-25(35)30(14-4-2-1-3-5-14)26(36)31(29)19(15)11-17-21(33)12-18(28)24(34)23(17)22/h1-8,10,12,19,22,32H,9,11H2 |
| InChIKey | KQYLWRLEPVGKIJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|