C28H23N3O5 — CID 6641847
(2S,10R)-2-(4-hydroxy-3-methylphenyl)-6-methyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone (PubChem CID 6641847) has the molecular formula C28H23N3O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is (2S,10R)-2-(4-hydroxy-3-methylphenyl)-6-methyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone.
| Compound Name | (2S,10R)-2-(4-hydroxy-3-methylphenyl)-6-methyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6641847 |
| Molecular Formula | C28H23N3O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | (2S,10R)-2-(4-hydroxy-3-methylphenyl)-6-methyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone |
| SMILES | CC1=CC(=O)C2=C(C[C@@H]3C(=CCn4c(=O)n(-c5ccccc5)c(=O)n43)[C@@H]2c2ccc(O)c(C)c2)C1=O |
| InChI | InChI=1S/C28H23N3O5/c1-15-12-17(8-9-22(15)32)24-19-10-11-29-27(35)30(18-6-4-3-5-7-18)28(36)31(29)21(19)14-20-25(24)23(33)13-16(2)26(20)34/h3-10,12-13,21,24,32H,11,14H2,1-2H3/t21-,24+/m1/s1 |
| InChIKey | WLNHTJBTODLBJV-QPPBQGQZSA-N |
| XLogP | 2.88 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|