C29H25N3O7 — CID 6641859
(2R,10R)-2-(4-hydroxy-2,6-dimethoxyphenyl)-6-methyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone (PubChem CID 6641859) has the molecular formula C29H25N3O7 and a molecular weight of 527.53 g/mol. Its IUPAC name is (2R,10R)-2-(4-hydroxy-2,6-dimethoxyphenyl)-6-methyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone.
| Compound Name | (2R,10R)-2-(4-hydroxy-2,6-dimethoxyphenyl)-6-methyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6641859 |
| Molecular Formula | C29H25N3O7 |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | (2R,10R)-2-(4-hydroxy-2,6-dimethoxyphenyl)-6-methyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone |
| SMILES | COc1cc(O)cc(OC)c1[C@H]1C2=CCn3c(=O)n(-c4ccccc4)c(=O)n3[C@@H]2CC2=C1C(=O)C=C(C)C2=O |
| InChI | InChI=1S/C29H25N3O7/c1-15-11-21(34)24-19(27(15)35)14-20-18(25(24)26-22(38-2)12-17(33)13-23(26)39-3)9-10-30-28(36)31(29(37)32(20)30)16-7-5-4-6-8-16/h4-9,11-13,20,25,33H,10,14H2,1-3H3/t20-,25+/m1/s1 |
| InChIKey | OBZDZLOJDMCXAU-NLFFAJNJSA-N |
| XLogP | 2.59 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|