C27H19BrIN3O6 — CID 4074429
2-(3-bromo-4-hydroxy-5-methoxyphenyl)-5-iodo-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone (PubChem CID 4074429) has the molecular formula C27H19BrIN3O6 and a molecular weight of 688.27 g/mol. Its IUPAC name is 2-(3-bromo-4-hydroxy-5-methoxyphenyl)-5-iodo-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone.
| Compound Name | 2-(3-bromo-4-hydroxy-5-methoxyphenyl)-5-iodo-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 4074429 |
| Molecular Formula | C27H19BrIN3O6 |
| Molecular Weight | 688.27 g/mol |
| Exact Mass | 686.95 |
| IUPAC Name | 2-(3-bromo-4-hydroxy-5-methoxyphenyl)-5-iodo-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone |
| SMILES | COc1cc(C2C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4C3CC3=C2C(=O)C(I)=CC3=O)cc(Br)c1O |
| InChI | InChI=1S/C27H19BrIN3O6/c1-38-21-10-13(9-17(28)24(21)34)22-15-7-8-30-26(36)31(14-5-3-2-4-6-14)27(37)32(30)19(15)11-16-20(33)12-18(29)25(35)23(16)22/h2-7,9-10,12,19,22,34H,8,11H2,1H3 |
| InChIKey | NBFFYRZHTHDIBN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|