C23H20IN3O7 — CID 6641618
(2R,10R)-2-(4-hydroxy-2,6-dimethoxyphenyl)-5-iodo-13-methyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone (PubChem CID 6641618) has the molecular formula C23H20IN3O7 and a molecular weight of 577.33 g/mol. Its IUPAC name is (2R,10R)-2-(4-hydroxy-2,6-dimethoxyphenyl)-5-iodo-13-methyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone.
| Compound Name | (2R,10R)-2-(4-hydroxy-2,6-dimethoxyphenyl)-5-iodo-13-methyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6641618 |
| Molecular Formula | C23H20IN3O7 |
| Molecular Weight | 577.33 g/mol |
| Exact Mass | 577.03 |
| IUPAC Name | (2R,10R)-2-(4-hydroxy-2,6-dimethoxyphenyl)-5-iodo-13-methyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone |
| SMILES | COc1cc(O)cc(OC)c1[C@H]1C2=CCn3c(=O)n(C)c(=O)n3[C@@H]2CC2=C1C(=O)C(I)=CC2=O |
| InChI | InChI=1S/C23H20IN3O7/c1-25-22(31)26-5-4-11-14(27(26)23(25)32)8-12-15(29)9-13(24)21(30)19(12)18(11)20-16(33-2)6-10(28)7-17(20)34-3/h4,6-7,9,14,18,28H,5,8H2,1-3H3/t14-,18+/m1/s1 |
| InChIKey | DRCQZBHDEZJYOC-KDOFPFPSSA-N |
| XLogP | 1.51 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|