C31H31N3O6 — CID 6641373
(2R,3S,8R,10R)-2-(4-hydroxy-2-methoxyphenyl)-3,5,6,8-tetramethyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 6641373) has the molecular formula C31H31N3O6 and a molecular weight of 541.60 g/mol. Its IUPAC name is (2R,3S,8R,10R)-2-(4-hydroxy-2-methoxyphenyl)-3,5,6,8-tetramethyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | (2R,3S,8R,10R)-2-(4-hydroxy-2-methoxyphenyl)-3,5,6,8-tetramethyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6641373 |
| Molecular Formula | C31H31N3O6 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | (2R,3S,8R,10R)-2-(4-hydroxy-2-methoxyphenyl)-3,5,6,8-tetramethyl-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | COc1cc(O)ccc1[C@H]1C2=CCn3c(=O)n(-c4ccccc4)c(=O)n3[C@@H]2C[C@@]2(C)C(=O)C(C)=C(C)C(=O)[C@@]12C |
| InChI | InChI=1S/C31H31N3O6/c1-17-18(2)27(37)31(4)25(22-12-11-20(35)15-24(22)40-5)21-13-14-32-28(38)33(19-9-7-6-8-10-19)29(39)34(32)23(21)16-30(31,3)26(17)36/h6-13,15,23,25,35H,14,16H2,1-5H3/t23-,25-,30+,31-/m1/s1 |
| InChIKey | UAPJITQTHGIXNV-PJAXNWDQSA-N |
| XLogP | 3.68 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|