C28H21Cl4N3O5 — CID 6641490
(2S,3S,8R,10R)-3,5,6,8-tetrachloro-2-(4-hydroxy-3,5-dimethylphenyl)-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 6641490) has the molecular formula C28H21Cl4N3O5 and a molecular weight of 621.30 g/mol. Its IUPAC name is (2S,3S,8R,10R)-3,5,6,8-tetrachloro-2-(4-hydroxy-3,5-dimethylphenyl)-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | (2S,3S,8R,10R)-3,5,6,8-tetrachloro-2-(4-hydroxy-3,5-dimethylphenyl)-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6641490 |
| Molecular Formula | C28H21Cl4N3O5 |
| Molecular Weight | 621.30 g/mol |
| Exact Mass | 619.02 |
| IUPAC Name | (2S,3S,8R,10R)-3,5,6,8-tetrachloro-2-(4-hydroxy-3,5-dimethylphenyl)-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | Cc1cc([C@H]2C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4[C@@H]3C[C@@]3(Cl)C(=O)C(Cl)=C(Cl)C(=O)[C@@]23Cl)cc(C)c1O |
| InChI | InChI=1S/C28H21Cl4N3O5/c1-13-10-15(11-14(2)22(13)36)19-17-8-9-33-25(39)34(16-6-4-3-5-7-16)26(40)35(33)18(17)12-27(31)23(37)20(29)21(30)24(38)28(19,27)32/h3-8,10-11,18-19,36H,9,12H2,1-2H3/t18-,19+,27-,28+/m1/s1 |
| InChIKey | XPSIGQBQKWSXGT-KHZCNSCYSA-N |
| XLogP | 4.59 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.30 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|