C31H18Cl3F5N4O6 — CID 4676484
11,15-dichloro-10-(3-chloro-4-hydroxy-5-methoxyphenyl)-13-(2,3,4,5,6-pentafluorophenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 4676484) has the molecular formula C31H18Cl3F5N4O6 and a molecular weight of 743.86 g/mol. Its IUPAC name is 11,15-dichloro-10-(3-chloro-4-hydroxy-5-methoxyphenyl)-13-(2,3,4,5,6-pentafluorophenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | 11,15-dichloro-10-(3-chloro-4-hydroxy-5-methoxyphenyl)-13-(2,3,4,5,6-pentafluorophenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 4676484 |
| Molecular Formula | C31H18Cl3F5N4O6 |
| Molecular Weight | 743.86 g/mol |
| Exact Mass | 742.02 |
| IUPAC Name | 11,15-dichloro-10-(3-chloro-4-hydroxy-5-methoxyphenyl)-13-(2,3,4,5,6-pentafluorophenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | COc1cc(C2C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4C3CC3(Cl)C(=O)N(c4c(F)c(F)c(F)c(F)c4F)C(=O)C23Cl)cc(Cl)c1O |
| InChI | InChI=1S/C31H18Cl3F5N4O6/c1-49-17-10-12(9-15(32)25(17)44)18-14-7-8-40-28(47)41(13-5-3-2-4-6-13)29(48)43(40)16(14)11-30(33)26(45)42(27(46)31(18,30)34)24-22(38)20(36)19(35)21(37)23(24)39/h2-7,9-10,16,18,44H,8,11H2,1H3 |
| InChIKey | BFMVNNBRLLMYJC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.86 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|