C29H19Cl4N3O6 — CID 6641544
(2R,3S,8R,10R)-3,5,6,8-tetrachloro-2-(6-hydroxy-4H-chromen-3-yl)-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 6641544) has the molecular formula C29H19Cl4N3O6 and a molecular weight of 647.30 g/mol. Its IUPAC name is (2R,3S,8R,10R)-3,5,6,8-tetrachloro-2-(6-hydroxy-4H-chromen-3-yl)-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | (2R,3S,8R,10R)-3,5,6,8-tetrachloro-2-(6-hydroxy-4H-chromen-3-yl)-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6641544 |
| Molecular Formula | C29H19Cl4N3O6 |
| Molecular Weight | 647.30 g/mol |
| Exact Mass | 645.00 |
| IUPAC Name | (2R,3S,8R,10R)-3,5,6,8-tetrachloro-2-(6-hydroxy-4H-chromen-3-yl)-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)[C@@]2(Cl)[C@@H](C3=COc4ccc(O)cc4C3)C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4[C@@H]3C[C@@]12Cl |
| InChI | InChI=1S/C29H19Cl4N3O6/c30-22-23(31)25(39)29(33)21(15-10-14-11-17(37)6-7-20(14)42-13-15)18-8-9-34-26(40)35(16-4-2-1-3-5-16)27(41)36(34)19(18)12-28(29,32)24(22)38/h1-8,11,13,19,21,37H,9-10,12H2/t19-,21+,28-,29+/m1/s1 |
| InChIKey | PRTLEVURBFIQDE-NSXKHKJLSA-N |
| XLogP | 4.32 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|