C36H30N2O6 — CID 3550685
6-(6-hydroxy-4H-chromen-3-yl)-6a-methyl-2,8-diphenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3550685) has the molecular formula C36H30N2O6 and a molecular weight of 586.64 g/mol. Its IUPAC name is 6-(6-hydroxy-4H-chromen-3-yl)-6a-methyl-2,8-diphenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(6-hydroxy-4H-chromen-3-yl)-6a-methyl-2,8-diphenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3550685 |
| Molecular Formula | C36H30N2O6 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | 6-(6-hydroxy-4H-chromen-3-yl)-6a-methyl-2,8-diphenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CC12C(=O)N(c3ccccc3)C(=O)C1CC1C(=CCC3C(=O)N(c4ccccc4)C(=O)C31)C2C1=COc2ccc(O)cc2C1 |
| InChI | InChI=1S/C36H30N2O6/c1-36-28(33(41)38(35(36)43)23-10-6-3-7-11-23)18-27-25(31(36)21-16-20-17-24(39)12-15-29(20)44-19-21)13-14-26-30(27)34(42)37(32(26)40)22-8-4-2-5-9-22/h2-13,15,17,19,26-28,30-31,39H,14,16,18H2,1H3 |
| InChIKey | OWSOUOXWTIURAF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|