C31H26ClFN2O6 — CID 4104196
8-(3-chloro-4-fluorophenyl)-6-(6-hydroxy-4H-chromen-3-yl)-2,6a-dimethyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4104196) has the molecular formula C31H26ClFN2O6 and a molecular weight of 577.01 g/mol. Its IUPAC name is 8-(3-chloro-4-fluorophenyl)-6-(6-hydroxy-4H-chromen-3-yl)-2,6a-dimethyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chloro-4-fluorophenyl)-6-(6-hydroxy-4H-chromen-3-yl)-2,6a-dimethyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4104196 |
| Molecular Formula | C31H26ClFN2O6 |
| Molecular Weight | 577.01 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | 8-(3-chloro-4-fluorophenyl)-6-(6-hydroxy-4H-chromen-3-yl)-2,6a-dimethyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CN1C(=O)C2CC=C3C(CC4C(=O)N(c5ccc(F)c(Cl)c5)C(=O)C4(C)C3C3=COc4ccc(O)cc4C3)C2C1=O |
| InChI | InChI=1S/C31H26ClFN2O6/c1-31-21(28(38)35(30(31)40)16-3-7-23(33)22(32)11-16)12-20-18(5-6-19-25(20)29(39)34(2)27(19)37)26(31)15-9-14-10-17(36)4-8-24(14)41-13-15/h3-5,7-8,10-11,13,19-21,25-26,36H,6,9,12H2,1-2H3 |
| InChIKey | AGHGRPWLKVUHOG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.01 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|