C29H26ClFN2O5 — CID 4590622
8-(3-chloro-4-fluorophenyl)-6-(4-hydroxy-3-methylphenyl)-2,6a-dimethyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4590622) has the molecular formula C29H26ClFN2O5 and a molecular weight of 536.99 g/mol. Its IUPAC name is 8-(3-chloro-4-fluorophenyl)-6-(4-hydroxy-3-methylphenyl)-2,6a-dimethyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chloro-4-fluorophenyl)-6-(4-hydroxy-3-methylphenyl)-2,6a-dimethyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4590622 |
| Molecular Formula | C29H26ClFN2O5 |
| Molecular Weight | 536.99 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | 8-(3-chloro-4-fluorophenyl)-6-(4-hydroxy-3-methylphenyl)-2,6a-dimethyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1cc(C2C3=CCC4C(=O)N(C)C(=O)C4C3CC3C(=O)N(c4ccc(F)c(Cl)c4)C(=O)C32C)ccc1O |
| InChI | InChI=1S/C29H26ClFN2O5/c1-13-10-14(4-9-22(13)34)24-16-6-7-17-23(27(37)32(3)25(17)35)18(16)12-19-26(36)33(28(38)29(19,24)2)15-5-8-21(31)20(30)11-15/h4-6,8-11,17-19,23-24,34H,7,12H2,1-3H3 |
| InChIKey | MNDXESBFNZHYBK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.99 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|