C35H29Cl2FN2O6 — CID 4258974
8-(3-chloro-4-fluorophenyl)-2-(3-chloro-4-methylphenyl)-6-(3-hydroxy-4-methoxyphenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4258974) has the molecular formula C35H29Cl2FN2O6 and a molecular weight of 663.53 g/mol. Its IUPAC name is 8-(3-chloro-4-fluorophenyl)-2-(3-chloro-4-methylphenyl)-6-(3-hydroxy-4-methoxyphenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chloro-4-fluorophenyl)-2-(3-chloro-4-methylphenyl)-6-(3-hydroxy-4-methoxyphenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4258974 |
| Molecular Formula | C35H29Cl2FN2O6 |
| Molecular Weight | 663.53 g/mol |
| Exact Mass | 662.14 |
| IUPAC Name | 8-(3-chloro-4-fluorophenyl)-2-(3-chloro-4-methylphenyl)-6-(3-hydroxy-4-methoxyphenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C2C3=CCC4C(=O)N(c5ccc(C)c(Cl)c5)C(=O)C4C3CC3C(=O)N(c4ccc(F)c(Cl)c4)C(=O)C32C)cc1O |
| InChI | InChI=1S/C35H29Cl2FN2O6/c1-16-4-6-18(13-24(16)36)39-31(42)21-9-8-20-22(29(21)33(39)44)15-23-32(43)40(19-7-10-26(38)25(37)14-19)34(45)35(23,2)30(20)17-5-11-28(46-3)27(41)12-17/h4-8,10-14,21-23,29-30,41H,9,15H2,1-3H3 |
| InChIKey | QSVZXHUWARLOFG-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.53 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|