C34H27ClFIN2O6 — CID 4230975
8-(3-chloro-4-fluorophenyl)-6-(3-hydroxy-4-methoxyphenyl)-2-(4-iodophenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4230975) has the molecular formula C34H27ClFIN2O6 and a molecular weight of 740.95 g/mol. Its IUPAC name is 8-(3-chloro-4-fluorophenyl)-6-(3-hydroxy-4-methoxyphenyl)-2-(4-iodophenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chloro-4-fluorophenyl)-6-(3-hydroxy-4-methoxyphenyl)-2-(4-iodophenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4230975 |
| Molecular Formula | C34H27ClFIN2O6 |
| Molecular Weight | 740.95 g/mol |
| Exact Mass | 740.06 |
| IUPAC Name | 8-(3-chloro-4-fluorophenyl)-6-(3-hydroxy-4-methoxyphenyl)-2-(4-iodophenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C2C3=CCC4C(=O)N(c5ccc(I)cc5)C(=O)C4C3CC3C(=O)N(c4ccc(F)c(Cl)c4)C(=O)C32C)cc1O |
| InChI | InChI=1S/C34H27ClFIN2O6/c1-34-23(31(42)39(33(34)44)19-8-11-25(36)24(35)14-19)15-22-20(29(34)16-3-12-27(45-2)26(40)13-16)9-10-21-28(22)32(43)38(30(21)41)18-6-4-17(37)5-7-18/h3-9,11-14,21-23,28-29,40H,10,15H2,1-2H3 |
| InChIKey | QBJIOFCDQSKIKS-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.95 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|