C33H25ClFIN2O5 — CID 3594242
8-(3-chloro-4-fluorophenyl)-6-(2-hydroxyphenyl)-2-(4-iodophenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3594242) has the molecular formula C33H25ClFIN2O5 and a molecular weight of 710.93 g/mol. Its IUPAC name is 8-(3-chloro-4-fluorophenyl)-6-(2-hydroxyphenyl)-2-(4-iodophenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chloro-4-fluorophenyl)-6-(2-hydroxyphenyl)-2-(4-iodophenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3594242 |
| Molecular Formula | C33H25ClFIN2O5 |
| Molecular Weight | 710.93 g/mol |
| Exact Mass | 710.05 |
| IUPAC Name | 8-(3-chloro-4-fluorophenyl)-6-(2-hydroxyphenyl)-2-(4-iodophenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CC12C(=O)N(c3ccc(F)c(Cl)c3)C(=O)C1CC1C(=CCC3C(=O)N(c4ccc(I)cc4)C(=O)C31)C2c1ccccc1O |
| InChI | InChI=1S/C33H25ClFIN2O5/c1-33-23(30(41)38(32(33)43)18-10-13-25(35)24(34)14-18)15-22-19(28(33)20-4-2-3-5-26(20)39)11-12-21-27(22)31(42)37(29(21)40)17-8-6-16(36)7-9-17/h2-11,13-14,21-23,27-28,39H,12,15H2,1H3 |
| InChIKey | KRFVYHALSSSVFL-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.93 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|