C30H25ClF2N2O7 — CID 4693666
3-[8-(3-chloro-4-fluorophenyl)-6-(3-fluoro-4-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid (PubChem CID 4693666) has the molecular formula C30H25ClF2N2O7 and a molecular weight of 598.99 g/mol. Its IUPAC name is 3-[8-(3-chloro-4-fluorophenyl)-6-(3-fluoro-4-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[8-(3-chloro-4-fluorophenyl)-6-(3-fluoro-4-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 4693666 |
| Molecular Formula | C30H25ClF2N2O7 |
| Molecular Weight | 598.99 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | 3-[8-(3-chloro-4-fluorophenyl)-6-(3-fluoro-4-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid |
| SMILES | CC12C(=O)N(c3ccc(F)c(Cl)c3)C(=O)C1CC1C(=CCC3C(=O)N(CCC(=O)O)C(=O)C31)C2c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C30H25ClF2N2O7/c1-30-18(27(40)35(29(30)42)14-3-6-20(32)19(31)11-14)12-17-15(25(30)13-2-7-22(36)21(33)10-13)4-5-16-24(17)28(41)34(26(16)39)9-8-23(37)38/h2-4,6-7,10-11,16-18,24-25,36H,5,8-9,12H2,1H3,(H,37,38) |
| InChIKey | SQIBWXQZBUPNMY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.99 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|