C30H26ClFN2O7 — CID 6657712
3-[(3aS,6S,6aS,9aR,10aS,10bR)-8-(3-chloro-4-fluorophenyl)-6-(4-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid (PubChem CID 6657712) has the molecular formula C30H26ClFN2O7 and a molecular weight of 581.00 g/mol. Its IUPAC name is 3-[(3aS,6S,6aS,9aR,10aS,10bR)-8-(3-chloro-4-fluorophenyl)-6-(4-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[(3aS,6S,6aS,9aR,10aS,10bR)-8-(3-chloro-4-fluorophenyl)-6-(4-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 6657712 |
| Molecular Formula | C30H26ClFN2O7 |
| Molecular Weight | 581.00 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | 3-[(3aS,6S,6aS,9aR,10aS,10bR)-8-(3-chloro-4-fluorophenyl)-6-(4-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid |
| SMILES | C[C@@]12C(=O)N(c3ccc(F)c(Cl)c3)C(=O)[C@@H]1C[C@@H]1C(=CC[C@@H]3C(=O)N(CCC(=O)O)C(=O)[C@@H]31)[C@@H]2c1ccc(O)cc1 |
| InChI | InChI=1S/C30H26ClFN2O7/c1-30-20(27(39)34(29(30)41)15-4-9-22(32)21(31)12-15)13-19-17(25(30)14-2-5-16(35)6-3-14)7-8-18-24(19)28(40)33(26(18)38)11-10-23(36)37/h2-7,9,12,18-20,24-25,35H,8,10-11,13H2,1H3,(H,36,37)/t18-,19+,20-,24-,25-,30+/m0/s1 |
| InChIKey | ISOANPHOEPXPLA-GMUCCVAUSA-N |
| XLogP | 3.89 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.00 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|