C37H34ClFN2O7 — CID 5200008
8-(3-chloro-4-fluorophenyl)-6-[4-(2-hydroxyethoxy)phenyl]-2-[2-(4-hydroxyphenyl)ethyl]-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5200008) has the molecular formula C37H34ClFN2O7 and a molecular weight of 673.14 g/mol. Its IUPAC name is 8-(3-chloro-4-fluorophenyl)-6-[4-(2-hydroxyethoxy)phenyl]-2-[2-(4-hydroxyphenyl)ethyl]-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chloro-4-fluorophenyl)-6-[4-(2-hydroxyethoxy)phenyl]-2-[2-(4-hydroxyphenyl)ethyl]-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5200008 |
| Molecular Formula | C37H34ClFN2O7 |
| Molecular Weight | 673.14 g/mol |
| Exact Mass | 672.20 |
| IUPAC Name | 8-(3-chloro-4-fluorophenyl)-6-[4-(2-hydroxyethoxy)phenyl]-2-[2-(4-hydroxyphenyl)ethyl]-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CC12C(=O)N(c3ccc(F)c(Cl)c3)C(=O)C1CC1C(=CCC3C(=O)N(CCc4ccc(O)cc4)C(=O)C31)C2c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C37H34ClFN2O7/c1-37-28(34(45)41(36(37)47)22-6-13-30(39)29(38)18-22)19-27-25(32(37)21-4-9-24(10-5-21)48-17-16-42)11-12-26-31(27)35(46)40(33(26)44)15-14-20-2-7-23(43)8-3-20/h2-11,13,18,26-28,31-32,42-43H,12,14-17,19H2,1H3 |
| InChIKey | BSTVHDRYTPATHB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.14 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|