C28H26ClFN4O6 — CID 6640775
(1R,10R,11S,15R)-13-(3-chloro-4-fluorophenyl)-10-[2-(2-hydroxyethoxy)phenyl]-4,11-dimethyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 6640775) has the molecular formula C28H26ClFN4O6 and a molecular weight of 568.99 g/mol. Its IUPAC name is (1R,10R,11S,15R)-13-(3-chloro-4-fluorophenyl)-10-[2-(2-hydroxyethoxy)phenyl]-4,11-dimethyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | (1R,10R,11S,15R)-13-(3-chloro-4-fluorophenyl)-10-[2-(2-hydroxyethoxy)phenyl]-4,11-dimethyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 6640775 |
| Molecular Formula | C28H26ClFN4O6 |
| Molecular Weight | 568.99 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | (1R,10R,11S,15R)-13-(3-chloro-4-fluorophenyl)-10-[2-(2-hydroxyethoxy)phenyl]-4,11-dimethyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | Cn1c(=O)n2n(c1=O)[C@@H]1C[C@H]3C(=O)N(c4ccc(F)c(Cl)c4)C(=O)[C@@]3(C)[C@@H](c3ccccc3OCCO)C1=CC2 |
| InChI | InChI=1S/C28H26ClFN4O6/c1-28-18(24(36)33(25(28)37)15-7-8-20(30)19(29)13-15)14-21-16(9-10-32-26(38)31(2)27(39)34(21)32)23(28)17-5-3-4-6-22(17)40-12-11-35/h3-9,13,18,21,23,35H,10-12,14H2,1-2H3/t18-,21+,23+,28+/m0/s1 |
| InChIKey | RENLRIQHPLEZRP-YEBDQZQTSA-N |
| XLogP | 2.38 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.99 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|