C25H27N3O6 — CID 6641048
(2R,3S,8R,10R)-2-[2-(2-hydroxyethoxy)phenyl]-3,5,13-trimethyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 6641048) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is (2R,3S,8R,10R)-2-[2-(2-hydroxyethoxy)phenyl]-3,5,13-trimethyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | (2R,3S,8R,10R)-2-[2-(2-hydroxyethoxy)phenyl]-3,5,13-trimethyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6641048 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | (2R,3S,8R,10R)-2-[2-(2-hydroxyethoxy)phenyl]-3,5,13-trimethyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | CC1=CC(=O)[C@@H]2C[C@@H]3C(=CCn4c(=O)n(C)c(=O)n43)[C@H](c3ccccc3OCCO)[C@]2(C)C1=O |
| InChI | InChI=1S/C25H27N3O6/c1-14-12-19(30)17-13-18-15(8-9-27-23(32)26(3)24(33)28(18)27)21(25(17,2)22(14)31)16-6-4-5-7-20(16)34-11-10-29/h4-8,12,17-18,21,29H,9-11,13H2,1-3H3/t17-,18+,21+,25+/m0/s1 |
| InChIKey | KBWAYDQIKRTLMW-FAYLVHGNSA-N |
| XLogP | 1.11 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|