C23H20BrN3O6 — CID 6641768
(2R,10R)-6-bromo-2-[2-(2-hydroxyethoxy)phenyl]-13-methyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone (PubChem CID 6641768) has the molecular formula C23H20BrN3O6 and a molecular weight of 514.33 g/mol. Its IUPAC name is (2R,10R)-6-bromo-2-[2-(2-hydroxyethoxy)phenyl]-13-methyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone.
| Compound Name | (2R,10R)-6-bromo-2-[2-(2-hydroxyethoxy)phenyl]-13-methyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6641768 |
| Molecular Formula | C23H20BrN3O6 |
| Molecular Weight | 514.33 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | (2R,10R)-6-bromo-2-[2-(2-hydroxyethoxy)phenyl]-13-methyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),3(8),5-triene-4,7,12,14-tetrone |
| SMILES | Cn1c(=O)n2n(c1=O)[C@@H]1CC3=C(C(=O)C=C(Br)C3=O)[C@@H](c3ccccc3OCCO)C1=CC2 |
| InChI | InChI=1S/C23H20BrN3O6/c1-25-22(31)26-7-6-12-16(27(26)23(25)32)10-14-20(17(29)11-15(24)21(14)30)19(12)13-4-2-3-5-18(13)33-9-8-28/h2-6,11,16,19,28H,7-10H2,1H3/t16-,19-/m1/s1 |
| InChIKey | MKOXVBQENPYIEX-VQIMIIECSA-N |
| XLogP | 1.12 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|