C25H21BrN2O7 — CID 6663107
(3aS,6R,11aS,11bR)-9-bromo-6-[2-(2-hydroxyethoxy)phenyl]-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxamide (PubChem CID 6663107) has the molecular formula C25H21BrN2O7 and a molecular weight of 541.35 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-9-bromo-6-[2-(2-hydroxyethoxy)phenyl]-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxamide.
| Compound Name | (3aS,6R,11aS,11bR)-9-bromo-6-[2-(2-hydroxyethoxy)phenyl]-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 6663107 |
| Molecular Formula | C25H21BrN2O7 |
| Molecular Weight | 541.35 g/mol |
| Exact Mass | 540.05 |
| IUPAC Name | (3aS,6R,11aS,11bR)-9-bromo-6-[2-(2-hydroxyethoxy)phenyl]-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxamide |
| SMILES | NC(=O)N1C(=O)[C@H]2[C@H](CC=C3[C@H](c4ccccc4OCCO)C4=C(C[C@H]32)C(=O)C(Br)=CC4=O)C1=O |
| InChI | InChI=1S/C25H21BrN2O7/c26-16-10-17(30)21-15(22(16)31)9-14-11(19(21)12-3-1-2-4-18(12)35-8-7-29)5-6-13-20(14)24(33)28(23(13)32)25(27)34/h1-5,10,13-14,19-20,29H,6-9H2,(H2,27,34)/t13-,14+,19+,20-/m0/s1 |
| InChIKey | XPTZZQLDLMFAFX-SMHQJORMSA-N |
| XLogP | 1.90 |
| TPSA | 144.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|