C31H26BrNO6 — CID 6664611
(3aS,6R,11aS,11bR)-2-(4-bromophenyl)-6-[2-(2-hydroxyethoxy)phenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6664611) has the molecular formula C31H26BrNO6 and a molecular weight of 588.45 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-2-(4-bromophenyl)-6-[2-(2-hydroxyethoxy)phenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-2-(4-bromophenyl)-6-[2-(2-hydroxyethoxy)phenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6664611 |
| Molecular Formula | C31H26BrNO6 |
| Molecular Weight | 588.45 g/mol |
| Exact Mass | 587.09 |
| IUPAC Name | (3aS,6R,11aS,11bR)-2-(4-bromophenyl)-6-[2-(2-hydroxyethoxy)phenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=CC(=O)C2=C(C[C@@H]3C(=CC[C@@H]4C(=O)N(c5ccc(Br)cc5)C(=O)[C@@H]43)[C@@H]2c2ccccc2OCCO)C1=O |
| InChI | InChI=1S/C31H26BrNO6/c1-16-14-24(35)28-23(29(16)36)15-22-19(26(28)20-4-2-3-5-25(20)39-13-12-34)10-11-21-27(22)31(38)33(30(21)37)18-8-6-17(32)7-9-18/h2-10,14,21-22,26-27,34H,11-13,15H2,1H3/t21-,22+,26+,27-/m0/s1 |
| InChIKey | ZXBUNWNSEYRNQO-BKNUMKMGSA-N |
| XLogP | 4.45 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|