C33H29NO6 — CID 3523823
2-(4-ethenylphenyl)-6-[2-(2-hydroxyethoxy)phenyl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3523823) has the molecular formula C33H29NO6 and a molecular weight of 535.60 g/mol. Its IUPAC name is 2-(4-ethenylphenyl)-6-[2-(2-hydroxyethoxy)phenyl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-ethenylphenyl)-6-[2-(2-hydroxyethoxy)phenyl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3523823 |
| Molecular Formula | C33H29NO6 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 2-(4-ethenylphenyl)-6-[2-(2-hydroxyethoxy)phenyl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | C=Cc1ccc(N2C(=O)C3CC=C4C(c5ccccc5OCCO)C5=C(CC4C3C2=O)C(=O)C=C(C)C5=O)cc1 |
| InChI | InChI=1S/C33H29NO6/c1-3-19-8-10-20(11-9-19)34-32(38)23-13-12-21-24(29(23)33(34)39)17-25-26(36)16-18(2)31(37)30(25)28(21)22-6-4-5-7-27(22)40-15-14-35/h3-12,16,23-24,28-29,35H,1,13-15,17H2,2H3 |
| InChIKey | IOIKLGFWUGILQO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|