C30H25BBrNO8 — CID 6663113
[3-[(3aS,6R,11aS,11bR)-9-bromo-6-[2-(2-hydroxyethoxy)phenyl]-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 6663113) has the molecular formula C30H25BBrNO8 and a molecular weight of 618.25 g/mol. Its IUPAC name is [3-[(3aS,6R,11aS,11bR)-9-bromo-6-[2-(2-hydroxyethoxy)phenyl]-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[(3aS,6R,11aS,11bR)-9-bromo-6-[2-(2-hydroxyethoxy)phenyl]-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 6663113 |
| Molecular Formula | C30H25BBrNO8 |
| Molecular Weight | 618.25 g/mol |
| Exact Mass | 617.09 |
| IUPAC Name | [3-[(3aS,6R,11aS,11bR)-9-bromo-6-[2-(2-hydroxyethoxy)phenyl]-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | O=C1C=C(Br)C(=O)C2=C1[C@@H](c1ccccc1OCCO)C1=CC[C@@H]3C(=O)N(c4cccc(B(O)O)c4)C(=O)[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C30H25BBrNO8/c32-22-14-23(35)27-21(28(22)36)13-20-17(25(27)18-6-1-2-7-24(18)41-11-10-34)8-9-19-26(20)30(38)33(29(19)37)16-5-3-4-15(12-16)31(39)40/h1-8,12,14,19-20,25-26,34,39-40H,9-11,13H2/t19-,20+,25+,26-/m0/s1 |
| InChIKey | ZHPXVNHXCJUSNX-XJQCFKMBSA-N |
| XLogP | 1.70 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|