C24H20BrNO6 — CID 6663104
(3aS,6R,11aS,11bR)-9-bromo-6-[2-(2-hydroxyethoxy)phenyl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6663104) has the molecular formula C24H20BrNO6 and a molecular weight of 498.33 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-9-bromo-6-[2-(2-hydroxyethoxy)phenyl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-9-bromo-6-[2-(2-hydroxyethoxy)phenyl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6663104 |
| Molecular Formula | C24H20BrNO6 |
| Molecular Weight | 498.33 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | (3aS,6R,11aS,11bR)-9-bromo-6-[2-(2-hydroxyethoxy)phenyl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C=C(Br)C(=O)C2=C1[C@@H](c1ccccc1OCCO)C1=CC[C@@H]3C(=O)NC(=O)[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C24H20BrNO6/c25-16-10-17(28)21-15(22(16)29)9-14-11(5-6-13-20(14)24(31)26-23(13)30)19(21)12-3-1-2-4-18(12)32-8-7-27/h1-5,10,13-14,19-20,27H,6-9H2,(H,26,30,31)/t13-,14+,19+,20-/m0/s1 |
| InChIKey | ODNBMXYHEBBCBV-SMHQJORMSA-N |
| XLogP | 2.11 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|