C25H20BrNO5 — CID 6662268
(3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxy-3-prop-2-enylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6662268) has the molecular formula C25H20BrNO5 and a molecular weight of 494.34 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxy-3-prop-2-enylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxy-3-prop-2-enylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6662268 |
| Molecular Formula | C25H20BrNO5 |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | (3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxy-3-prop-2-enylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | C=CCc1cccc([C@H]2C3=CC[C@@H]4C(=O)NC(=O)[C@@H]4[C@@H]3CC3=C2C(=O)C=C(Br)C3=O)c1O |
| InChI | InChI=1S/C25H20BrNO5/c1-2-4-11-5-3-6-13(22(11)29)19-12-7-8-14-20(25(32)27-24(14)31)15(12)9-16-21(19)18(28)10-17(26)23(16)30/h2-3,5-7,10,14-15,19-20,29H,1,4,8-9H2,(H,27,31,32)/t14-,15+,19+,20-/m0/s1 |
| InChIKey | KFOSWRZPUNLLNY-BWMZKYQQSA-N |
| XLogP | 3.17 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|