C38H28BrNO6 — CID 3625514
2-(4-benzoylphenyl)-9-bromo-6-(2-hydroxy-3-prop-2-enylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3625514) has the molecular formula C38H28BrNO6 and a molecular weight of 674.55 g/mol. Its IUPAC name is 2-(4-benzoylphenyl)-9-bromo-6-(2-hydroxy-3-prop-2-enylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-benzoylphenyl)-9-bromo-6-(2-hydroxy-3-prop-2-enylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3625514 |
| Molecular Formula | C38H28BrNO6 |
| Molecular Weight | 674.55 g/mol |
| Exact Mass | 673.11 |
| IUPAC Name | 2-(4-benzoylphenyl)-9-bromo-6-(2-hydroxy-3-prop-2-enylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | C=CCc1cccc(C2C3=CCC4C(=O)N(c5ccc(C(=O)c6ccccc6)cc5)C(=O)C4C3CC3=C2C(=O)C=C(Br)C3=O)c1O |
| InChI | InChI=1S/C38H28BrNO6/c1-2-7-20-10-6-11-25(35(20)43)31-24-16-17-26-32(27(24)18-28-33(31)30(41)19-29(39)36(28)44)38(46)40(37(26)45)23-14-12-22(13-15-23)34(42)21-8-4-3-5-9-21/h2-6,8-16,19,26-27,31-32,43H,1,7,17-18H2 |
| InChIKey | BKVGBNIPTHGDBB-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.55 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|