C33H27NO7 — CID 4140148
3-[6-(2-hydroxy-3-prop-2-enylphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid (PubChem CID 4140148) has the molecular formula C33H27NO7 and a molecular weight of 549.58 g/mol. Its IUPAC name is 3-[6-(2-hydroxy-3-prop-2-enylphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[6-(2-hydroxy-3-prop-2-enylphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 4140148 |
| Molecular Formula | C33H27NO7 |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 3-[6-(2-hydroxy-3-prop-2-enylphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid |
| SMILES | C=CCc1cccc(C2C3=CCC4C(=O)N(c5cccc(C(=O)O)c5)C(=O)C4C3CC3=C2C(=O)C(C)=CC3=O)c1O |
| InChI | InChI=1S/C33H27NO7/c1-3-6-17-7-5-10-21(30(17)37)26-20-11-12-22-27(23(20)15-24-25(35)13-16(2)29(36)28(24)26)32(39)34(31(22)38)19-9-4-8-18(14-19)33(40)41/h3-5,7-11,13-14,22-23,26-27,37H,1,6,12,15H2,2H3,(H,40,41) |
| InChIKey | SJLQYNYVGIKAMB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|