C31H25NO8 — CID 4155281
3-[6-(2-hydroxy-6-methoxyphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid (PubChem CID 4155281) has the molecular formula C31H25NO8 and a molecular weight of 539.54 g/mol. Its IUPAC name is 3-[6-(2-hydroxy-6-methoxyphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[6-(2-hydroxy-6-methoxyphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 4155281 |
| Molecular Formula | C31H25NO8 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 3-[6-(2-hydroxy-6-methoxyphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid |
| SMILES | COc1cccc(O)c1C1C2=CCC3C(=O)N(c4cccc(C(=O)O)c4)C(=O)C3C2CC2=C1C(=O)C(C)=CC2=O |
| InChI | InChI=1S/C31H25NO8/c1-14-11-22(34)20-13-19-17(25(26(20)28(14)35)27-21(33)7-4-8-23(27)40-2)9-10-18-24(19)30(37)32(29(18)36)16-6-3-5-15(12-16)31(38)39/h3-9,11-12,18-19,24-25,33H,10,13H2,1-2H3,(H,38,39) |
| InChIKey | PQNCNLJBROJTJF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|