C33H27NO8 — CID 3503530
3-[6-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid (PubChem CID 3503530) has the molecular formula C33H27NO8 and a molecular weight of 565.58 g/mol. Its IUPAC name is 3-[6-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[6-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 3503530 |
| Molecular Formula | C33H27NO8 |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | 3-[6-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid |
| SMILES | COc1cc(C=CC2C3=CCC4C(=O)N(c5cccc(C(=O)O)c5)C(=O)C4C3CC3=C2C(=O)C(C)=CC3=O)ccc1O |
| InChI | InChI=1S/C33H27NO8/c1-16-12-26(36)24-15-23-20(21(28(24)30(16)37)8-6-17-7-11-25(35)27(13-17)42-2)9-10-22-29(23)32(39)34(31(22)38)19-5-3-4-18(14-19)33(40)41/h3-9,11-14,21-23,29,35H,10,15H2,1-2H3,(H,40,41) |
| InChIKey | VJTHJMMXSBVMFJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|