C23H17BrINO6 — CID 4608367
9-bromo-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4608367) has the molecular formula C23H17BrINO6 and a molecular weight of 610.20 g/mol. Its IUPAC name is 9-bromo-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 9-bromo-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4608367 |
| Molecular Formula | C23H17BrINO6 |
| Molecular Weight | 610.20 g/mol |
| Exact Mass | 608.93 |
| IUPAC Name | 9-bromo-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)NC(=O)C4C3CC3=C2C(=O)C=C(Br)C3=O)cc(I)c1O |
| InChI | InChI=1S/C23H17BrINO6/c1-32-16-5-8(4-14(25)21(16)29)17-9-2-3-10-18(23(31)26-22(10)30)11(9)6-12-19(17)15(27)7-13(24)20(12)28/h2,4-5,7,10-11,17-18,29H,3,6H2,1H3,(H,26,30,31) |
| InChIKey | MOWNNCBFYQBRKN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.20 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|