C24H21NO6 — CID 6663940
(3aS,6R,11aS,11bR)-6-(3-hydroxy-4-methoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6663940) has the molecular formula C24H21NO6 and a molecular weight of 419.43 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-6-(3-hydroxy-4-methoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-6-(3-hydroxy-4-methoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6663940 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (3aS,6R,11aS,11bR)-6-(3-hydroxy-4-methoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1ccc([C@H]2C3=CC[C@@H]4C(=O)NC(=O)[C@@H]4[C@@H]3CC3=C2C(=O)C=C(C)C3=O)cc1O |
| InChI | InChI=1S/C24H21NO6/c1-10-7-17(27)21-15(22(10)28)9-14-12(4-5-13-20(14)24(30)25-23(13)29)19(21)11-3-6-18(31-2)16(26)8-11/h3-4,6-8,13-14,19-20,26H,5,9H2,1-2H3,(H,25,29,30)/t13-,14+,19-,20-/m0/s1 |
| InChIKey | QRODWNUVKXELEW-ILWKUFEGSA-N |
| XLogP | 2.12 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|