C25H23NO6 — CID 6666182
(3aS,6S,11aS,11bR)-6-[4-(2-hydroxyethoxy)phenyl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6666182) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is (3aS,6S,11aS,11bR)-6-[4-(2-hydroxyethoxy)phenyl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6S,11aS,11bR)-6-[4-(2-hydroxyethoxy)phenyl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6666182 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | (3aS,6S,11aS,11bR)-6-[4-(2-hydroxyethoxy)phenyl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=CC(=O)C2=C(C1=O)[C@@H](c1ccc(OCCO)cc1)C1=CC[C@@H]3C(=O)NC(=O)[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C25H23NO6/c1-12-10-19(28)18-11-17-15(6-7-16-21(17)25(31)26-24(16)30)20(22(18)23(12)29)13-2-4-14(5-3-13)32-9-8-27/h2-6,10,16-17,20-21,27H,7-9,11H2,1H3,(H,26,30,31)/t16-,17+,20-,21-/m0/s1 |
| InChIKey | WAUUPOIMGLKONZ-JWWGGVBKSA-N |
| XLogP | 1.77 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|