C27H27NO6 — CID 6666157
(3aS,6S,11aS,11bR)-2-ethyl-6-[4-(2-hydroxyethoxy)phenyl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6666157) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is (3aS,6S,11aS,11bR)-2-ethyl-6-[4-(2-hydroxyethoxy)phenyl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6S,11aS,11bR)-2-ethyl-6-[4-(2-hydroxyethoxy)phenyl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6666157 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | (3aS,6S,11aS,11bR)-2-ethyl-6-[4-(2-hydroxyethoxy)phenyl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCN1C(=O)[C@H]2[C@H](CC=C3[C@H](c4ccc(OCCO)cc4)C4=C(C[C@H]32)C(=O)C=C(C)C4=O)C1=O |
| InChI | InChI=1S/C27H27NO6/c1-3-28-26(32)18-9-8-17-19(23(18)27(28)33)13-20-21(30)12-14(2)25(31)24(20)22(17)15-4-6-16(7-5-15)34-11-10-29/h4-8,12,18-19,22-23,29H,3,9-11,13H2,1-2H3/t18-,19+,22-,23-/m0/s1 |
| InChIKey | GWBSUHFYJWZVIS-YDLSIGKMSA-N |
| XLogP | 2.51 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|