C23H17BrN2O6 — CID 3517566
9-bromo-6-(4-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxamide (PubChem CID 3517566) has the molecular formula C23H17BrN2O6 and a molecular weight of 497.30 g/mol. Its IUPAC name is 9-bromo-6-(4-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxamide.
| Compound Name | 9-bromo-6-(4-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 3517566 |
| Molecular Formula | C23H17BrN2O6 |
| Molecular Weight | 497.30 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | 9-bromo-6-(4-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxamide |
| SMILES | NC(=O)N1C(=O)C2CC=C3C(c4ccc(O)cc4)C4=C(CC3C2C1=O)C(=O)C(Br)=CC4=O |
| InChI | InChI=1S/C23H17BrN2O6/c24-15-8-16(28)19-14(20(15)29)7-13-11(17(19)9-1-3-10(27)4-2-9)5-6-12-18(13)22(31)26(21(12)30)23(25)32/h1-5,8,12-13,17-18,27H,6-7H2,(H2,25,32) |
| InChIKey | QJHMZJQZRPWNDX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|