C26H19BrN2O7 — CID 6663297
(3aS,6R,11aS,11bR)-9-bromo-6-(6-hydroxy-4H-chromen-3-yl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxamide (PubChem CID 6663297) has the molecular formula C26H19BrN2O7 and a molecular weight of 551.35 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-9-bromo-6-(6-hydroxy-4H-chromen-3-yl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxamide.
| Compound Name | (3aS,6R,11aS,11bR)-9-bromo-6-(6-hydroxy-4H-chromen-3-yl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 6663297 |
| Molecular Formula | C26H19BrN2O7 |
| Molecular Weight | 551.35 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | (3aS,6R,11aS,11bR)-9-bromo-6-(6-hydroxy-4H-chromen-3-yl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxamide |
| SMILES | NC(=O)N1C(=O)[C@H]2[C@H](CC=C3[C@H](C4=COc5ccc(O)cc5C4)C4=C(C[C@H]32)C(=O)C(Br)=CC4=O)C1=O |
| InChI | InChI=1S/C26H19BrN2O7/c27-17-8-18(31)22-16(23(17)32)7-15-13(2-3-14-21(15)25(34)29(24(14)33)26(28)35)20(22)11-5-10-6-12(30)1-4-19(10)36-9-11/h1-2,4,6,8-9,14-15,20-21,30H,3,5,7H2,(H2,28,35)/t14-,15+,20-,21-/m0/s1 |
| InChIKey | BKMPSVLLGRPDHF-YQMDMEMYSA-N |
| XLogP | 2.58 |
| TPSA | 144.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|