C35H29BrN2O7 — CID 3460185
9-bromo-6-(6-hydroxy-4H-chromen-3-yl)-2-(4-morpholin-4-ylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3460185) has the molecular formula C35H29BrN2O7 and a molecular weight of 669.53 g/mol. Its IUPAC name is 9-bromo-6-(6-hydroxy-4H-chromen-3-yl)-2-(4-morpholin-4-ylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 9-bromo-6-(6-hydroxy-4H-chromen-3-yl)-2-(4-morpholin-4-ylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3460185 |
| Molecular Formula | C35H29BrN2O7 |
| Molecular Weight | 669.53 g/mol |
| Exact Mass | 668.12 |
| IUPAC Name | 9-bromo-6-(6-hydroxy-4H-chromen-3-yl)-2-(4-morpholin-4-ylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C=C(Br)C(=O)C2=C1C(C1=COc3ccc(O)cc3C1)C1=CCC3C(=O)N(c4ccc(N5CCOCC5)cc4)C(=O)C3C1C2 |
| InChI | InChI=1S/C35H29BrN2O7/c36-27-16-28(40)32-26(33(27)41)15-25-23(30(32)19-13-18-14-22(39)5-8-29(18)45-17-19)6-7-24-31(25)35(43)38(34(24)42)21-3-1-20(2-4-21)37-9-11-44-12-10-37/h1-6,8,14,16-17,24-25,30-31,39H,7,9-13,15H2 |
| InChIKey | FGXNYASRWMGTFA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|