C26H21NO6 — CID 5006494
6-(6-hydroxy-4H-chromen-3-yl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5006494) has the molecular formula C26H21NO6 and a molecular weight of 443.46 g/mol. Its IUPAC name is 6-(6-hydroxy-4H-chromen-3-yl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(6-hydroxy-4H-chromen-3-yl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5006494 |
| Molecular Formula | C26H21NO6 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 6-(6-hydroxy-4H-chromen-3-yl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=CC(=O)C2=C(C1=O)C(C1=COc3ccc(O)cc3C1)C1=CCC3C(=O)NC(=O)C3C1C2 |
| InChI | InChI=1S/C26H21NO6/c1-11-6-19(29)18-9-17-15(3-4-16-22(17)26(32)27-25(16)31)21(23(18)24(11)30)13-7-12-8-14(28)2-5-20(12)33-10-13/h2-3,5-6,8,10,16-17,21-22,28H,4,7,9H2,1H3,(H,27,31,32) |
| InChIKey | DXAPKPLIAIRJDM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|