C23H18BrNO5 — CID 6665080
(3aS,6R,11aS,11bR)-6-(5-bromo-2-hydroxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6665080) has the molecular formula C23H18BrNO5 and a molecular weight of 468.30 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-6-(5-bromo-2-hydroxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-6-(5-bromo-2-hydroxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6665080 |
| Molecular Formula | C23H18BrNO5 |
| Molecular Weight | 468.30 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | (3aS,6R,11aS,11bR)-6-(5-bromo-2-hydroxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=CC(=O)C2=C(C1=O)[C@@H](c1cc(Br)ccc1O)C1=CC[C@@H]3C(=O)NC(=O)[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C23H18BrNO5/c1-9-6-17(27)15-8-13-11(3-4-12-19(13)23(30)25-22(12)29)18(20(15)21(9)28)14-7-10(24)2-5-16(14)26/h2-3,5-7,12-13,18-19,26H,4,8H2,1H3,(H,25,29,30)/t12-,13+,18+,19-/m0/s1 |
| InChIKey | YRJCPVKGGXYLDJ-PRSFTHDCSA-N |
| XLogP | 2.87 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|