C30H27NO8 — CID 4174338
4-[6-(6-hydroxy-4H-chromen-3-yl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]butanoic acid (PubChem CID 4174338) has the molecular formula C30H27NO8 and a molecular weight of 529.55 g/mol. Its IUPAC name is 4-[6-(6-hydroxy-4H-chromen-3-yl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[6-(6-hydroxy-4H-chromen-3-yl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 4174338 |
| Molecular Formula | C30H27NO8 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | 4-[6-(6-hydroxy-4H-chromen-3-yl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]butanoic acid |
| SMILES | CC1=CC(=O)C2=C(CC3C(=CCC4C(=O)N(CCCC(=O)O)C(=O)C43)C2C2=COc3ccc(O)cc3C2)C1=O |
| InChI | InChI=1S/C30H27NO8/c1-14-9-22(33)27-21(28(14)36)12-20-18(25(27)16-10-15-11-17(32)4-7-23(15)39-13-16)5-6-19-26(20)30(38)31(29(19)37)8-2-3-24(34)35/h4-5,7,9,11,13,19-20,25-26,32H,2-3,6,8,10,12H2,1H3,(H,34,35) |
| InChIKey | SCGQQXCPVUFKDM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|