C33H31NO7 — CID 6664706
6-[(3aS,6R,11aS,11bR)-6-(2-hydroxynaphthalen-1-yl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid (PubChem CID 6664706) has the molecular formula C33H31NO7 and a molecular weight of 553.61 g/mol. Its IUPAC name is 6-[(3aS,6R,11aS,11bR)-6-(2-hydroxynaphthalen-1-yl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid.
| Compound Name | 6-[(3aS,6R,11aS,11bR)-6-(2-hydroxynaphthalen-1-yl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 6664706 |
| Molecular Formula | C33H31NO7 |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | 6-[(3aS,6R,11aS,11bR)-6-(2-hydroxynaphthalen-1-yl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid |
| SMILES | CC1=CC(=O)C2=C(C[C@@H]3C(=CC[C@@H]4C(=O)N(CCCCCC(=O)O)C(=O)[C@@H]43)[C@@H]2c2c(O)ccc3ccccc23)C1=O |
| InChI | InChI=1S/C33H31NO7/c1-17-15-25(36)29-23(31(17)39)16-22-20(30(29)28-19-8-5-4-7-18(19)10-13-24(28)35)11-12-21-27(22)33(41)34(32(21)40)14-6-2-3-9-26(37)38/h4-5,7-8,10-11,13,15,21-22,27,30,35H,2-3,6,9,12,14,16H2,1H3,(H,37,38)/t21-,22+,27-,30+/m0/s1 |
| InChIKey | DGLUNWORDXAEHC-NPZXKIDOSA-N |
| XLogP | 4.62 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|