C29H23NO7 — CID 6664683
methyl (3aS,6R,11aS,11bR)-6-(2-hydroxynaphthalen-1-yl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate (PubChem CID 6664683) has the molecular formula C29H23NO7 and a molecular weight of 497.50 g/mol. Its IUPAC name is methyl (3aS,6R,11aS,11bR)-6-(2-hydroxynaphthalen-1-yl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate.
| Compound Name | methyl (3aS,6R,11aS,11bR)-6-(2-hydroxynaphthalen-1-yl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 6664683 |
| Molecular Formula | C29H23NO7 |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | methyl (3aS,6R,11aS,11bR)-6-(2-hydroxynaphthalen-1-yl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)[C@H]2[C@H](CC=C3[C@H](c4c(O)ccc5ccccc45)C4=C(C[C@H]32)C(=O)C(C)=CC4=O)C1=O |
| InChI | InChI=1S/C29H23NO7/c1-13-11-21(32)24-19(26(13)33)12-18-16(8-9-17-22(18)28(35)30(27(17)34)29(36)37-2)25(24)23-15-6-4-3-5-14(15)7-10-20(23)31/h3-8,10-11,17-18,22,25,31H,9,12H2,1-2H3/t17-,18+,22-,25+/m0/s1 |
| InChIKey | CTNKBRHTBMSUMQ-SNMCCPJMSA-N |
| XLogP | 3.74 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|