C35H29NO5 — CID 3339719
2-(4-ethylphenyl)-6-(2-hydroxynaphthalen-1-yl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3339719) has the molecular formula C35H29NO5 and a molecular weight of 543.62 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-6-(2-hydroxynaphthalen-1-yl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-ethylphenyl)-6-(2-hydroxynaphthalen-1-yl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3339719 |
| Molecular Formula | C35H29NO5 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 2-(4-ethylphenyl)-6-(2-hydroxynaphthalen-1-yl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCc1ccc(N2C(=O)C3CC=C4C(c5c(O)ccc6ccccc56)C5=C(CC4C3C2=O)C(=O)C=C(C)C5=O)cc1 |
| InChI | InChI=1S/C35H29NO5/c1-3-19-8-11-21(12-9-19)36-34(40)24-14-13-23-25(29(24)35(36)41)17-26-28(38)16-18(2)33(39)32(26)31(23)30-22-7-5-4-6-20(22)10-15-27(30)37/h4-13,15-16,24-25,29,31,37H,3,14,17H2,1-2H3 |
| InChIKey | QVRYVIDIHFJSCK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|