C40H28N2O6 — CID 6664692
(3aS,6R,11aS,11bR)-2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(2-hydroxynaphthalen-1-yl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6664692) has the molecular formula C40H28N2O6 and a molecular weight of 632.67 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(2-hydroxynaphthalen-1-yl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(2-hydroxynaphthalen-1-yl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6664692 |
| Molecular Formula | C40H28N2O6 |
| Molecular Weight | 632.67 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | (3aS,6R,11aS,11bR)-2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(2-hydroxynaphthalen-1-yl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=CC(=O)C2=C(C[C@@H]3C(=CC[C@@H]4C(=O)N(c5ccc(-c6nc7ccccc7o6)cc5)C(=O)[C@@H]43)[C@@H]2c2c(O)ccc3ccccc23)C1=O |
| InChI | InChI=1S/C40H28N2O6/c1-20-18-31(44)35-28(37(20)45)19-27-25(36(35)34-24-7-3-2-6-21(24)12-17-30(34)43)15-16-26-33(27)40(47)42(39(26)46)23-13-10-22(11-14-23)38-41-29-8-4-5-9-32(29)48-38/h2-15,17-18,26-27,33,36,43H,16,19H2,1H3/t26-,27+,33-,36+/m0/s1 |
| InChIKey | VTMIWLMNDZNJRT-FYCJNZENSA-N |
| XLogP | 6.99 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.67 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|