C36H25BrN2O7 — CID 4525590
2-[4-(1,3-benzoxazol-2-yl)phenyl]-9-bromo-6-(2-hydroxy-5-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4525590) has the molecular formula C36H25BrN2O7 and a molecular weight of 677.51 g/mol. Its IUPAC name is 2-[4-(1,3-benzoxazol-2-yl)phenyl]-9-bromo-6-(2-hydroxy-5-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-9-bromo-6-(2-hydroxy-5-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4525590 |
| Molecular Formula | C36H25BrN2O7 |
| Molecular Weight | 677.51 g/mol |
| Exact Mass | 676.08 |
| IUPAC Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-9-bromo-6-(2-hydroxy-5-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1ccc(O)c(C2C3=CCC4C(=O)N(c5ccc(-c6nc7ccccc7o6)cc5)C(=O)C4C3CC3=C2C(=O)C=C(Br)C3=O)c1 |
| InChI | InChI=1S/C36H25BrN2O7/c1-45-19-10-13-27(40)23(14-19)30-20-11-12-21-31(22(20)15-24-32(30)28(41)16-25(37)33(24)42)36(44)39(35(21)43)18-8-6-17(7-9-18)34-38-26-4-2-3-5-29(26)46-34/h2-11,13-14,16,21-22,30-31,40H,12,15H2,1H3 |
| InChIKey | FPEGDROXNDEAKH-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|