C35H22BrClN2O6 — CID 6662070
(3aS,6R,11aS,11bR)-2-[4-(1,3-benzoxazol-2-yl)phenyl]-9-bromo-6-(5-chloro-2-hydroxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6662070) has the molecular formula C35H22BrClN2O6 and a molecular weight of 681.93 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-2-[4-(1,3-benzoxazol-2-yl)phenyl]-9-bromo-6-(5-chloro-2-hydroxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-2-[4-(1,3-benzoxazol-2-yl)phenyl]-9-bromo-6-(5-chloro-2-hydroxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6662070 |
| Molecular Formula | C35H22BrClN2O6 |
| Molecular Weight | 681.93 g/mol |
| Exact Mass | 680.03 |
| IUPAC Name | (3aS,6R,11aS,11bR)-2-[4-(1,3-benzoxazol-2-yl)phenyl]-9-bromo-6-(5-chloro-2-hydroxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C=C(Br)C(=O)C2=C1[C@@H](c1cc(Cl)ccc1O)C1=CC[C@@H]3C(=O)N(c4ccc(-c5nc6ccccc6o5)cc4)C(=O)[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C35H22BrClN2O6/c36-24-15-27(41)31-23(32(24)42)14-21-19(29(31)22-13-17(37)7-12-26(22)40)10-11-20-30(21)35(44)39(34(20)43)18-8-5-16(6-9-18)33-38-25-3-1-2-4-28(25)45-33/h1-10,12-13,15,20-21,29-30,40H,11,14H2/t20-,21+,29+,30-/m0/s1 |
| InChIKey | YBBYNAFVCSUIHY-URNJEZNFSA-N |
| XLogP | 6.82 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.93 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|