C24H21NO8 — CID 6666089
methyl (3aS,6S,11aS,11bR)-6-[5-(hydroxymethyl)furan-2-yl]-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate (PubChem CID 6666089) has the molecular formula C24H21NO8 and a molecular weight of 451.43 g/mol. Its IUPAC name is methyl (3aS,6S,11aS,11bR)-6-[5-(hydroxymethyl)furan-2-yl]-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate.
| Compound Name | methyl (3aS,6S,11aS,11bR)-6-[5-(hydroxymethyl)furan-2-yl]-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 6666089 |
| Molecular Formula | C24H21NO8 |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | methyl (3aS,6S,11aS,11bR)-6-[5-(hydroxymethyl)furan-2-yl]-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)[C@H]2[C@H](CC=C3[C@H](c4ccc(CO)o4)C4=C(C[C@H]32)C(=O)C=C(C)C4=O)C1=O |
| InChI | InChI=1S/C24H21NO8/c1-10-7-16(27)15-8-14-12(19(20(15)21(10)28)17-6-3-11(9-26)33-17)4-5-13-18(14)23(30)25(22(13)29)24(31)32-2/h3-4,6-7,13-14,18-19,26H,5,8-9H2,1-2H3/t13-,14+,18-,19+/m0/s1 |
| InChIKey | XVKFYAAUQXEKOD-QABNGEJJSA-N |
| XLogP | 1.97 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|